C16H29N2O10PS — CID 151349739
methyl 4-[2-[3-[[(2R)-2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl]amino]propanoylamino]ethylsulfanyl]-4-oxobutanoate (PubChem CID 151349739) has the molecular formula C16H29N2O10PS and a molecular weight of 472.45 g/mol. Its IUPAC name is methyl 4-[2-[3-[[(2R)-2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl]amino]propanoylamino]ethylsulfanyl]-4-oxobutanoate.
| Compound Name | methyl 4-[2-[3-[[(2R)-2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl]amino]propanoylamino]ethylsulfanyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 151349739 |
| Molecular Formula | C16H29N2O10PS |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | methyl 4-[2-[3-[[(2R)-2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl]amino]propanoylamino]ethylsulfanyl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)O |
| InChI | InChI=1S/C16H29N2O10PS/c1-16(2,10-28-29(24,25)26)14(22)15(23)18-7-6-11(19)17-8-9-30-13(21)5-4-12(20)27-3/h14,22H,4-10H2,1-3H3,(H,17,19)(H,18,23)(H2,24,25,26)/t14-/m0/s1 |
| InChIKey | OMFPVKRVWLDKAY-AWEZNQCLSA-N |
| XLogP | -0.68 |
| TPSA | 188.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|