C11H23N2O7P — CID 170595812
[4-[[3-(ethylamino)-3-oxopropyl]amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen phosphate (PubChem CID 170595812) has the molecular formula C11H23N2O7P and a molecular weight of 326.29 g/mol. Its IUPAC name is [4-[[3-(ethylamino)-3-oxopropyl]amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen phosphate.
| Compound Name | [4-[[3-(ethylamino)-3-oxopropyl]amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 170595812 |
| Molecular Formula | C11H23N2O7P |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [4-[[3-(ethylamino)-3-oxopropyl]amino]-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen phosphate |
| SMILES | CCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)O |
| InChI | InChI=1S/C11H23N2O7P/c1-4-12-8(14)5-6-13-10(16)9(15)11(2,3)7-20-21(17,18)19/h9,15H,4-7H2,1-3H3,(H,12,14)(H,13,16)(H2,17,18,19) |
| InChIKey | DEHAYQZRMSJERS-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|