C17H31N2O11PS — CID 156904733
dimethyl 2-[2-[3-[[(2R)-2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl]amino]propanoylamino]ethylsulfanyl]butanedioate (PubChem CID 156904733) has the molecular formula C17H31N2O11PS and a molecular weight of 502.48 g/mol. Its IUPAC name is dimethyl 2-[2-[3-[[(2R)-2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl]amino]propanoylamino]ethylsulfanyl]butanedioate.
| Compound Name | dimethyl 2-[2-[3-[[(2R)-2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl]amino]propanoylamino]ethylsulfanyl]butanedioate |
|---|---|
| PubChem CID | 156904733 |
| Molecular Formula | C17H31N2O11PS |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | dimethyl 2-[2-[3-[[(2R)-2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl]amino]propanoylamino]ethylsulfanyl]butanedioate |
| SMILES | COC(=O)CC(SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)O)C(=O)OC |
| InChI | InChI=1S/C17H31N2O11PS/c1-17(2,10-30-31(25,26)27)14(22)15(23)19-6-5-12(20)18-7-8-32-11(16(24)29-4)9-13(21)28-3/h11,14,22H,5-10H2,1-4H3,(H,18,20)(H,19,23)(H2,25,26,27)/t11?,14-/m0/s1 |
| InChIKey | WBFSCHRMAULRNL-IAXJKZSUSA-N |
| XLogP | -1.06 |
| TPSA | 197.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|