C19H38N2O13P2 — CID 59125224
[3-hydroxy-4-[[7-[(2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl)amino]-4-oxoheptyl]amino]-2,2-dimethyl-4-oxobutyl] dihydrogen phosphate (PubChem CID 59125224) has the molecular formula C19H38N2O13P2 and a molecular weight of 564.46 g/mol. Its IUPAC name is [3-hydroxy-4-[[7-[(2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl)amino]-4-oxoheptyl]amino]-2,2-dimethyl-4-oxobutyl] dihydrogen phosphate.
| Compound Name | [3-hydroxy-4-[[7-[(2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl)amino]-4-oxoheptyl]amino]-2,2-dimethyl-4-oxobutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59125224 |
| Molecular Formula | C19H38N2O13P2 |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [3-hydroxy-4-[[7-[(2-hydroxy-3,3-dimethyl-4-phosphonooxybutanoyl)amino]-4-oxoheptyl]amino]-2,2-dimethyl-4-oxobutyl] dihydrogen phosphate |
| SMILES | CC(C)(COP(=O)(O)O)C(O)C(=O)NCCCC(=O)CCCNC(=O)C(O)C(C)(C)COP(=O)(O)O |
| InChI | InChI=1S/C19H38N2O13P2/c1-18(2,11-33-35(27,28)29)14(23)16(25)20-9-5-7-13(22)8-6-10-21-17(26)15(24)19(3,4)12-34-36(30,31)32/h14-15,23-24H,5-12H2,1-4H3,(H,20,25)(H,21,26)(H2,27,28,29)(H2,30,31,32) |
| InChIKey | FZHPIRGZLMXFAH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 249.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|