C12H25INO6P — CID 126656888
tert-butyl [3-hydroxy-4-(2-iodoethylamino)-2,2-dimethyl-4-oxobutyl] hydrogen phosphate (PubChem CID 126656888) has the molecular formula C12H25INO6P and a molecular weight of 437.21 g/mol. Its IUPAC name is tert-butyl [3-hydroxy-4-(2-iodoethylamino)-2,2-dimethyl-4-oxobutyl] hydrogen phosphate.
| Compound Name | tert-butyl [3-hydroxy-4-(2-iodoethylamino)-2,2-dimethyl-4-oxobutyl] hydrogen phosphate |
|---|---|
| PubChem CID | 126656888 |
| Molecular Formula | C12H25INO6P |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | tert-butyl [3-hydroxy-4-(2-iodoethylamino)-2,2-dimethyl-4-oxobutyl] hydrogen phosphate |
| SMILES | CC(C)(C)OP(=O)(O)OCC(C)(C)C(O)C(=O)NCCI |
| InChI | InChI=1S/C12H25INO6P/c1-11(2,3)20-21(17,18)19-8-12(4,5)9(15)10(16)14-7-6-13/h9,15H,6-8H2,1-5H3,(H,14,16)(H,17,18) |
| InChIKey | ABZVRCFEYMJJHB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|