C18H40N3O8P — CID 163384907
ethane;[3-hydroxy-4-[[3-[[(2E)-2-methoxyiminopropyl]amino]-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] methyl hydrogen phosphate (PubChem CID 163384907) has the molecular formula C18H40N3O8P and a molecular weight of 457.51 g/mol. Its IUPAC name is ethane;[3-hydroxy-4-[[3-[[(2E)-2-methoxyiminopropyl]amino]-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] methyl hydrogen phosphate.
| Compound Name | ethane;[3-hydroxy-4-[[3-[[(2E)-2-methoxyiminopropyl]amino]-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 163384907 |
| Molecular Formula | C18H40N3O8P |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | ethane;[3-hydroxy-4-[[3-[[(2E)-2-methoxyiminopropyl]amino]-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] methyl hydrogen phosphate |
| SMILES | CC.CC.CO/N=C(\C)CNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OC |
| InChI | InChI=1S/C14H28N3O8P.2C2H6/c1-10(17-23-4)8-16-11(18)6-7-15-13(20)12(19)14(2,3)9-25-26(21,22)24-5;2*1-2/h12,19H,6-9H2,1-5H3,(H,15,20)(H,16,18)(H,21,22);2*1-2H3/b17-10+;; |
| InChIKey | WJFZSPLMYZSNCG-PHPLCDBTSA-N |
| XLogP | 1.83 |
| TPSA | 155.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|