C17H37IN2O7P- — CID 163829694
[4-(3-ethyliodanuidylbutylamino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] [3-hydroxy-2-(methylamino)butyl] hydrogen phosphate (PubChem CID 163829694) has the molecular formula C17H37IN2O7P- and a molecular weight of 539.37 g/mol. Its IUPAC name is [4-(3-ethyliodanuidylbutylamino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] [3-hydroxy-2-(methylamino)butyl] hydrogen phosphate.
| Compound Name | [4-(3-ethyliodanuidylbutylamino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] [3-hydroxy-2-(methylamino)butyl] hydrogen phosphate |
|---|---|
| PubChem CID | 163829694 |
| Molecular Formula | C17H37IN2O7P- |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | [4-(3-ethyliodanuidylbutylamino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] [3-hydroxy-2-(methylamino)butyl] hydrogen phosphate |
| SMILES | CC[I-]C(C)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OCC(NC)C(C)O |
| InChI | InChI=1S/C17H37IN2O7P/c1-7-18-12(2)8-9-20-16(23)15(22)17(4,5)11-27-28(24,25)26-10-14(19-6)13(3)21/h12-15,19,21-22H,7-11H2,1-6H3,(H,20,23)(H,24,25)/q-1 |
| InChIKey | OTFVARDUFRJSFK-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|