C21H41O7PS — CID 148921748
tert-butyl (11-tert-butylsulfanyl-3-hydroxy-2,2-dimethyl-4,8-dioxoundecyl) hydrogen phosphate (PubChem CID 148921748) has the molecular formula C21H41O7PS and a molecular weight of 468.59 g/mol. Its IUPAC name is tert-butyl (11-tert-butylsulfanyl-3-hydroxy-2,2-dimethyl-4,8-dioxoundecyl) hydrogen phosphate.
| Compound Name | tert-butyl (11-tert-butylsulfanyl-3-hydroxy-2,2-dimethyl-4,8-dioxoundecyl) hydrogen phosphate |
|---|---|
| PubChem CID | 148921748 |
| Molecular Formula | C21H41O7PS |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | tert-butyl (11-tert-butylsulfanyl-3-hydroxy-2,2-dimethyl-4,8-dioxoundecyl) hydrogen phosphate |
| SMILES | CC(C)(C)OP(=O)(O)OCC(C)(C)C(O)C(=O)CCCC(=O)CCCSC(C)(C)C |
| InChI | InChI=1S/C21H41O7PS/c1-19(2,3)28-29(25,26)27-15-21(7,8)18(24)17(23)13-9-11-16(22)12-10-14-30-20(4,5)6/h18,24H,9-15H2,1-8H3,(H,25,26) |
| InChIKey | PKFCFPXOPBYXPW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|