C22H43O7PS — CID 147385516
(11-tert-butylsulfanyl-3-hydroxy-2,2-dimethyl-4,8-dioxoundecyl) 2,2-dimethylpropyl hydrogen phosphate (PubChem CID 147385516) has the molecular formula C22H43O7PS and a molecular weight of 482.62 g/mol. Its IUPAC name is (11-tert-butylsulfanyl-3-hydroxy-2,2-dimethyl-4,8-dioxoundecyl) 2,2-dimethylpropyl hydrogen phosphate.
| Compound Name | (11-tert-butylsulfanyl-3-hydroxy-2,2-dimethyl-4,8-dioxoundecyl) 2,2-dimethylpropyl hydrogen phosphate |
|---|---|
| PubChem CID | 147385516 |
| Molecular Formula | C22H43O7PS |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (11-tert-butylsulfanyl-3-hydroxy-2,2-dimethyl-4,8-dioxoundecyl) 2,2-dimethylpropyl hydrogen phosphate |
| SMILES | CC(C)(C)COP(=O)(O)OCC(C)(C)C(O)C(=O)CCCC(=O)CCCSC(C)(C)C |
| InChI | InChI=1S/C22H43O7PS/c1-20(2,3)15-28-30(26,27)29-16-22(7,8)19(25)18(24)13-9-11-17(23)12-10-14-31-21(4,5)6/h19,25H,9-16H2,1-8H3,(H,26,27) |
| InChIKey | DLUWFGGONRAKTQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|