C20H41N2O7PS — CID 139436777
[4-[[3-[2-(3,3-dimethylbutylsulfanyl)ethylamino]-3-oxopropyl]amino]-3-hydroxy-4-oxobutyl] 2,2-dimethylpropyl hydrogen phosphate (PubChem CID 139436777) has the molecular formula C20H41N2O7PS and a molecular weight of 484.60 g/mol. Its IUPAC name is [4-[[3-[2-(3,3-dimethylbutylsulfanyl)ethylamino]-3-oxopropyl]amino]-3-hydroxy-4-oxobutyl] 2,2-dimethylpropyl hydrogen phosphate.
| Compound Name | [4-[[3-[2-(3,3-dimethylbutylsulfanyl)ethylamino]-3-oxopropyl]amino]-3-hydroxy-4-oxobutyl] 2,2-dimethylpropyl hydrogen phosphate |
|---|---|
| PubChem CID | 139436777 |
| Molecular Formula | C20H41N2O7PS |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | [4-[[3-[2-(3,3-dimethylbutylsulfanyl)ethylamino]-3-oxopropyl]amino]-3-hydroxy-4-oxobutyl] 2,2-dimethylpropyl hydrogen phosphate |
| SMILES | CC(C)(C)CCSCCNC(=O)CCNC(=O)C(O)CCOP(=O)(O)OCC(C)(C)C |
| InChI | InChI=1S/C20H41N2O7PS/c1-19(2,3)9-13-31-14-11-21-17(24)7-10-22-18(25)16(23)8-12-28-30(26,27)29-15-20(4,5)6/h16,23H,7-15H2,1-6H3,(H,21,24)(H,22,25)(H,26,27) |
| InChIKey | CVDDZRIZABICQR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|