C10H19N2O9PS — CID 134267095
2-[3-[[(2R)-2-hydroxy-4-phosphonooxybutanoyl]amino]propanoylamino]-3-sulfanylpropanoic acid (PubChem CID 134267095) has the molecular formula C10H19N2O9PS and a molecular weight of 374.31 g/mol. Its IUPAC name is 2-[3-[[(2R)-2-hydroxy-4-phosphonooxybutanoyl]amino]propanoylamino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[3-[[(2R)-2-hydroxy-4-phosphonooxybutanoyl]amino]propanoylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134267095 |
| Molecular Formula | C10H19N2O9PS |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-[3-[[(2R)-2-hydroxy-4-phosphonooxybutanoyl]amino]propanoylamino]-3-sulfanylpropanoic acid |
| SMILES | O=C(CCNC(=O)[C@H](O)CCOP(=O)(O)O)NC(CS)C(=O)O |
| InChI | InChI=1S/C10H19N2O9PS/c13-7(2-4-21-22(18,19)20)9(15)11-3-1-8(14)12-6(5-23)10(16)17/h6-7,13,23H,1-5H2,(H,11,15)(H,12,14)(H,16,17)(H2,18,19,20)/t6?,7-/m1/s1 |
| InChIKey | GDPWRLBZKJAXIX-COBSHVIPSA-N |
| XLogP | -2.15 |
| TPSA | 182.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|