C17H36N2O4S — CID 144975351
ethane;2-hydroxy-4-methoxy-3,3-dimethyl-N-[3-oxo-3-(2-propylsulfanylethylamino)propyl]butanamide (PubChem CID 144975351) has the molecular formula C17H36N2O4S and a molecular weight of 364.55 g/mol. Its IUPAC name is ethane;2-hydroxy-4-methoxy-3,3-dimethyl-N-[3-oxo-3-(2-propylsulfanylethylamino)propyl]butanamide.
| Compound Name | ethane;2-hydroxy-4-methoxy-3,3-dimethyl-N-[3-oxo-3-(2-propylsulfanylethylamino)propyl]butanamide |
|---|---|
| PubChem CID | 144975351 |
| Molecular Formula | C17H36N2O4S |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | ethane;2-hydroxy-4-methoxy-3,3-dimethyl-N-[3-oxo-3-(2-propylsulfanylethylamino)propyl]butanamide |
| SMILES | CC.CCCSCCNC(=O)CCNC(=O)C(O)C(C)(C)COC |
| InChI | InChI=1S/C15H30N2O4S.C2H6/c1-5-9-22-10-8-16-12(18)6-7-17-14(20)13(19)15(2,3)11-21-4;1-2/h13,19H,5-11H2,1-4H3,(H,16,18)(H,17,20);1-2H3 |
| InChIKey | WYYHCBZDNGRRFP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|