C18H28N2O8S — CID 156904698
methyl (E)-4-[2-[3-[[(2R)-4-acetyloxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethylsulfanyl]-4-oxobut-2-enoate (PubChem CID 156904698) has the molecular formula C18H28N2O8S and a molecular weight of 432.50 g/mol. Its IUPAC name is methyl (E)-4-[2-[3-[[(2R)-4-acetyloxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethylsulfanyl]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[2-[3-[[(2R)-4-acetyloxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethylsulfanyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 156904698 |
| Molecular Formula | C18H28N2O8S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | methyl (E)-4-[2-[3-[[(2R)-4-acetyloxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethylsulfanyl]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COC(C)=O |
| InChI | InChI=1S/C18H28N2O8S/c1-12(21)28-11-18(2,3)16(25)17(26)20-8-7-13(22)19-9-10-29-15(24)6-5-14(23)27-4/h5-6,16,25H,7-11H2,1-4H3,(H,19,22)(H,20,26)/b6-5+/t16-/m0/s1 |
| InChIKey | QUYMSTJGNIKEOF-JFDDCEBESA-N |
| XLogP | -0.45 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|