C23H40N3O10S+ — CID 156904737
[(2R)-3-carboxy-2-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-[2-(3-oxobutanoylsulfanyl)ethylamino]propyl]amino]butoxy]carbonyloxypropyl]-trimethylazanium (PubChem CID 156904737) has the molecular formula C23H40N3O10S+ and a molecular weight of 550.65 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-[2-(3-oxobutanoylsulfanyl)ethylamino]propyl]amino]butoxy]carbonyloxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-[2-(3-oxobutanoylsulfanyl)ethylamino]propyl]amino]butoxy]carbonyloxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156904737 |
| Molecular Formula | C23H40N3O10S+ |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [(2R)-3-carboxy-2-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-[2-(3-oxobutanoylsulfanyl)ethylamino]propyl]amino]butoxy]carbonyloxypropyl]-trimethylazanium |
| SMILES | CC(=O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C23H39N3O10S/c1-15(27)11-19(31)37-10-9-24-17(28)7-8-25-21(33)20(32)23(2,3)14-35-22(34)36-16(12-18(29)30)13-26(4,5)6/h16,20,32H,7-14H2,1-6H3,(H2-,24,25,28,29,30,33)/p+1/t16-,20+/m1/s1 |
| InChIKey | UATORTKDUQSZRV-UZLBHIALSA-O |
| XLogP | -0.06 |
| TPSA | 185.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|