C17H26N2O8S — CID 146598319
(E)-4-[2-[3-[(4-acetyloxy-2-hydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethylsulfanyl]-4-oxobut-2-enoic acid (PubChem CID 146598319) has the molecular formula C17H26N2O8S and a molecular weight of 418.47 g/mol. Its IUPAC name is (E)-4-[2-[3-[(4-acetyloxy-2-hydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethylsulfanyl]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[3-[(4-acetyloxy-2-hydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethylsulfanyl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 146598319 |
| Molecular Formula | C17H26N2O8S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (E)-4-[2-[3-[(4-acetyloxy-2-hydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethylsulfanyl]-4-oxobut-2-enoic acid |
| SMILES | CC(=O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H26N2O8S/c1-11(20)27-10-17(2,3)15(25)16(26)19-7-6-12(21)18-8-9-28-14(24)5-4-13(22)23/h4-5,15,25H,6-10H2,1-3H3,(H,18,21)(H,19,26)(H,22,23)/b5-4+ |
| InChIKey | DQUCCDSTTDJFMD-SNAWJCMRSA-N |
| XLogP | -0.54 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|