C17H28N2O7S — CID 156904694
[(3R)-3-acetyloxy-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] acetate (PubChem CID 156904694) has the molecular formula C17H28N2O7S and a molecular weight of 404.49 g/mol. Its IUPAC name is [(3R)-3-acetyloxy-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] acetate.
| Compound Name | [(3R)-3-acetyloxy-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] acetate |
|---|---|
| PubChem CID | 156904694 |
| Molecular Formula | C17H28N2O7S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(3R)-3-acetyloxy-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] acetate |
| SMILES | CC(=O)OCC(C)(C)[C@@H](OC(C)=O)C(=O)NCCC(=O)NCCSC(C)=O |
| InChI | InChI=1S/C17H28N2O7S/c1-11(20)25-10-17(4,5)15(26-12(2)21)16(24)19-7-6-14(23)18-8-9-27-13(3)22/h15H,6-10H2,1-5H3,(H,18,23)(H,19,24)/t15-/m0/s1 |
| InChIKey | KLFJRLUYKKDJCZ-HNNXBMFYSA-N |
| XLogP | 0.41 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|