C19H27N3O6S — CID 74763348
[(2R)-1-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]amino]-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl] pyridine-3-carboxylate (PubChem CID 74763348) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is [(2R)-1-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]amino]-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl] pyridine-3-carboxylate.
| Compound Name | [(2R)-1-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]amino]-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 74763348 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [(2R)-1-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]amino]-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl] pyridine-3-carboxylate |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@H](OC(=O)c1cccnc1)C(C)(C)CO |
| InChI | InChI=1S/C19H27N3O6S/c1-13(24)29-10-9-21-15(25)6-8-22-17(26)16(19(2,3)12-23)28-18(27)14-5-4-7-20-11-14/h4-5,7,11,16,23H,6,8-10,12H2,1-3H3,(H,21,25)(H,22,26)/t16-/m0/s1 |
| InChIKey | PQKQZDBMSIXYRX-INIZCTEOSA-N |
| XLogP | 0.53 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|