C7H17NO9P2 — CID 118797877
[[(3R)-4-amino-3-hydroxy-2,2-dimethyl-4-oxobutoxy]-hydroxyphosphoryl] methyl hydrogen phosphate (PubChem CID 118797877) has the molecular formula C7H17NO9P2 and a molecular weight of 321.16 g/mol. Its IUPAC name is [[(3R)-4-amino-3-hydroxy-2,2-dimethyl-4-oxobutoxy]-hydroxyphosphoryl] methyl hydrogen phosphate.
| Compound Name | [[(3R)-4-amino-3-hydroxy-2,2-dimethyl-4-oxobutoxy]-hydroxyphosphoryl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 118797877 |
| Molecular Formula | C7H17NO9P2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | [[(3R)-4-amino-3-hydroxy-2,2-dimethyl-4-oxobutoxy]-hydroxyphosphoryl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OP(=O)(O)OCC(C)(C)[C@@H](O)C(N)=O |
| InChI | InChI=1S/C7H17NO9P2/c1-7(2,5(9)6(8)10)4-16-19(13,14)17-18(11,12)15-3/h5,9H,4H2,1-3H3,(H2,8,10)(H,11,12)(H,13,14)/t5-/m0/s1 |
| InChIKey | AHXCJIFUZFNMCS-YFKPBYRVSA-N |
| XLogP | -0.26 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|