C8H22N2O7P2 — CID 102093654
[(2-amino-2-methylpropoxy)-hydroxyphosphoryl] (2-amino-2-methylpropyl) hydrogen phosphate (PubChem CID 102093654) has the molecular formula C8H22N2O7P2 and a molecular weight of 320.22 g/mol. Its IUPAC name is [(2-amino-2-methylpropoxy)-hydroxyphosphoryl] (2-amino-2-methylpropyl) hydrogen phosphate.
| Compound Name | [(2-amino-2-methylpropoxy)-hydroxyphosphoryl] (2-amino-2-methylpropyl) hydrogen phosphate |
|---|---|
| PubChem CID | 102093654 |
| Molecular Formula | C8H22N2O7P2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(2-amino-2-methylpropoxy)-hydroxyphosphoryl] (2-amino-2-methylpropyl) hydrogen phosphate |
| SMILES | CC(C)(N)COP(=O)(O)OP(=O)(O)OCC(C)(C)N |
| InChI | InChI=1S/C8H22N2O7P2/c1-7(2,9)5-15-18(11,12)17-19(13,14)16-6-8(3,4)10/h5-6,9-10H2,1-4H3,(H,11,12)(H,13,14) |
| InChIKey | KJPHQPADYRYDFP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 154.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|