C16H29NO6 — CID 13367346
4-[[4-(3,3-dimethylbutanoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]butanoic acid (PubChem CID 13367346) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is 4-[[4-(3,3-dimethylbutanoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]butanoic acid.
| Compound Name | 4-[[4-(3,3-dimethylbutanoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 13367346 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-[[4-(3,3-dimethylbutanoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]butanoic acid |
| SMILES | CC(C)(C)CC(=O)OCC(C)(C)C(O)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C16H29NO6/c1-15(2,3)9-12(20)23-10-16(4,5)13(21)14(22)17-8-6-7-11(18)19/h13,21H,6-10H2,1-5H3,(H,17,22)(H,18,19) |
| InChIKey | LTJDVEYCFCUCQQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|