C29H43NO6 — CID 121246123
3-[[(2R)-2-hydroxy-4-[(5Z,8Z,14Z,17Z)-icosa-5,8,14,17-tetraen-11-ynoyl]oxy-3,3-dimethylbutanoyl]amino]propanoic acid (PubChem CID 121246123) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is 3-[[(2R)-2-hydroxy-4-[(5Z,8Z,14Z,17Z)-icosa-5,8,14,17-tetraen-11-ynoyl]oxy-3,3-dimethylbutanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2R)-2-hydroxy-4-[(5Z,8Z,14Z,17Z)-icosa-5,8,14,17-tetraen-11-ynoyl]oxy-3,3-dimethylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 121246123 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | 3-[[(2R)-2-hydroxy-4-[(5Z,8Z,14Z,17Z)-icosa-5,8,14,17-tetraen-11-ynoyl]oxy-3,3-dimethylbutanoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\CC#CC/C=C\C/C=C\CCCC(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C29H43NO6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(33)36-24-29(2,3)27(34)28(35)30-23-22-25(31)32/h5-6,8-9,14-15,17-18,27,34H,4,7,10,13,16,19-24H2,1-3H3,(H,30,35)(H,31,32)/b6-5-,9-8-,15-14-,18-17-/t27-/m0/s1 |
| InChIKey | MPUPZQPSNZGFFG-XEUUAWRKSA-N |
| XLogP | 4.88 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|