C31H50N2O4S — CID 90184307
[2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 90184307) has the molecular formula C31H50N2O4S and a molecular weight of 546.82 g/mol. Its IUPAC name is [2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 90184307 |
| Molecular Formula | C31H50N2O4S |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | [2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(C)(C)CC(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C31H50N2O4S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-30(36)37-27-31(2,3)26-29(35)32-23-22-28(34)33-24-25-38/h5-6,8-9,11-12,14-15,17-18,38H,4,7,10,13,16,19-27H2,1-3H3,(H,32,35)(H,33,34)/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | BLZUXMUEFIFPRX-AAQCHOMXSA-N |
| XLogP | 6.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|