C30H48NO5+ — CID 145103859
3-[[(2R)-4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-2,3,3-trimethylbutanoyl]amino]propanoyloxidanium (PubChem CID 145103859) has the molecular formula C30H48NO5+ and a molecular weight of 502.72 g/mol. Its IUPAC name is 3-[[(2R)-4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-2,3,3-trimethylbutanoyl]amino]propanoyloxidanium.
| Compound Name | 3-[[(2R)-4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-2,3,3-trimethylbutanoyl]amino]propanoyloxidanium |
|---|---|
| PubChem CID | 145103859 |
| Molecular Formula | C30H48NO5+ |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | 3-[[(2R)-4-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxy-2,3,3-trimethylbutanoyl]amino]propanoyloxidanium |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(C)(C)[C@@H](C)C(=O)NCCC(=O)[OH2+] |
| InChI | InChI=1S/C30H47NO5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(34)36-25-30(3,4)26(2)29(35)31-24-23-27(32)33/h6-7,9-10,12-13,15-16,18-19,26H,5,8,11,14,17,20-25H2,1-4H3,(H,31,35)(H,32,33)/p+1/b7-6-,10-9-,13-12-,16-15-,19-18-/t26-/m0/s1 |
| InChIKey | CWUCGBPHBUVGOH-MRIAZUNISA-O |
| XLogP | 5.87 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|