C31H49NO6 — CID 123874635
3-[[4-(11-ethylicosa-5,8,11,14,17-pentaenoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoic acid (PubChem CID 123874635) has the molecular formula C31H49NO6 and a molecular weight of 531.73 g/mol. Its IUPAC name is 3-[[4-(11-ethylicosa-5,8,11,14,17-pentaenoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoic acid.
| Compound Name | 3-[[4-(11-ethylicosa-5,8,11,14,17-pentaenoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 123874635 |
| Molecular Formula | C31H49NO6 |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.36 |
| IUPAC Name | 3-[[4-(11-ethylicosa-5,8,11,14,17-pentaenoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
| SMILES | CCC=CCC=CCC=C(CC)CC=CCC=CCCCC(=O)OCC(C)(C)C(O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C31H49NO6/c1-5-7-8-9-11-14-17-20-26(6-2)21-18-15-12-10-13-16-19-22-28(35)38-25-31(3,4)29(36)30(37)32-24-23-27(33)34/h7-8,10-11,13-15,18,20,29,36H,5-6,9,12,16-17,19,21-25H2,1-4H3,(H,32,37)(H,33,34) |
| InChIKey | RXQYUYYWBUSNSW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|