C31H47NO6 — CID 90184378
3-[[(2R)-4-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoic acid (PubChem CID 90184378) has the molecular formula C31H47NO6 and a molecular weight of 529.72 g/mol. Its IUPAC name is 3-[[(2R)-4-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2R)-4-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 90184378 |
| Molecular Formula | C31H47NO6 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | 3-[[(2R)-4-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C31H47NO6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-28(35)38-26-31(2,3)29(36)30(37)32-25-24-27(33)34/h5-6,8-9,11-12,14-15,17-18,20-21,29,36H,4,7,10,13,16,19,22-26H2,1-3H3,(H,32,37)(H,33,34)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-/t29-/m0/s1 |
| InChIKey | CETKYINPYJFIAZ-HTGXZGLSSA-N |
| XLogP | 5.99 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|