C36H61NO5 — CID 144639313
[(3R)-3-ethoxy-2,2-dimethyl-4-oxo-4-(3-oxobutylamino)butyl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate;molecular hydrogen;propane (PubChem CID 144639313) has the molecular formula C36H61NO5 and a molecular weight of 587.89 g/mol. Its IUPAC name is [(3R)-3-ethoxy-2,2-dimethyl-4-oxo-4-(3-oxobutylamino)butyl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate;molecular hydrogen;propane.
| Compound Name | [(3R)-3-ethoxy-2,2-dimethyl-4-oxo-4-(3-oxobutylamino)butyl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate;molecular hydrogen;propane |
|---|---|
| PubChem CID | 144639313 |
| Molecular Formula | C36H61NO5 |
| Molecular Weight | 587.89 g/mol |
| Exact Mass | 587.45 |
| IUPAC Name | [(3R)-3-ethoxy-2,2-dimethyl-4-oxo-4-(3-oxobutylamino)butyl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate;molecular hydrogen;propane |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)OCC(C)(C)[C@@H](OCC)C(=O)NCCC(C)=O.CCC.[H][H] |
| InChI | InChI=1S/C33H51NO5.C3H8.H2/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-30(36)39-28-33(4,5)31(38-7-2)32(37)34-27-26-29(3)35;1-3-2;/h8-9,11-12,14-15,17-18,20-21,23-24,31H,6-7,10,13,16,19,22,25-28H2,1-5H3,(H,34,37);3H2,1-2H3;1H/b9-8-,12-11-,15-14-,18-17-,21-20-,24-23-;;/t31-;;/m0../s1 |
| InChIKey | UZMHPUPYLUGFBX-XJCYRIQYSA-N |
| XLogP | 8.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.89 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|