C33H54N2O5S — CID 144600573
[(3R)-3-hydroxy-2,2-dimethyl-4-[3-(2-methylsulfanylethylamino)oxypropylamino]-4-oxobutyl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate (PubChem CID 144600573) has the molecular formula C33H54N2O5S and a molecular weight of 590.87 g/mol. Its IUPAC name is [(3R)-3-hydroxy-2,2-dimethyl-4-[3-(2-methylsulfanylethylamino)oxypropylamino]-4-oxobutyl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate.
| Compound Name | [(3R)-3-hydroxy-2,2-dimethyl-4-[3-(2-methylsulfanylethylamino)oxypropylamino]-4-oxobutyl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate |
|---|---|
| PubChem CID | 144600573 |
| Molecular Formula | C33H54N2O5S |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | [(3R)-3-hydroxy-2,2-dimethyl-4-[3-(2-methylsulfanylethylamino)oxypropylamino]-4-oxobutyl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)OCC(C)(C)[C@@H](O)C(=O)NCCCONCCSC |
| InChI | InChI=1S/C33H54N2O5S/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-30(36)39-29-33(2,3)31(37)32(38)34-25-23-27-40-35-26-28-41-4/h6-7,9-10,12-13,15-16,18-19,21-22,31,35,37H,5,8,11,14,17,20,23-29H2,1-4H3,(H,34,38)/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21-/t31-/m0/s1 |
| InChIKey | JNKCZEOUNZNZOH-SHTDOVBQSA-N |
| XLogP | 6.39 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|