C40H70N2O5S — CID 144607891
ethane;2-[3-[[(2R)-2-hydroxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethylsulfanyl (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate;pentane (PubChem CID 144607891) has the molecular formula C40H70N2O5S and a molecular weight of 691.08 g/mol. Its IUPAC name is ethane;2-[3-[[(2R)-2-hydroxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethylsulfanyl (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate;pentane.
| Compound Name | ethane;2-[3-[[(2R)-2-hydroxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethylsulfanyl (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate;pentane |
|---|---|
| PubChem CID | 144607891 |
| Molecular Formula | C40H70N2O5S |
| Molecular Weight | 691.08 g/mol |
| Exact Mass | 690.50 |
| IUPAC Name | ethane;2-[3-[[(2R)-2-hydroxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethylsulfanyl (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate;pentane |
| SMILES | CC.CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)OSCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CC.CCCCC |
| InChI | InChI=1S/C33H52N2O5S.C5H12.C2H6/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-30(37)40-41-28-27-34-29(36)25-26-35-32(39)31(38)33(3,4)6-2;1-3-5-4-2;1-2/h7-8,10-11,13-14,16-17,19-20,22-23,31,38H,5-6,9,12,15,18,21,24-28H2,1-4H3,(H,34,36)(H,35,39);3-5H2,1-2H3;1-2H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22-;;/t31-;;/m0../s1 |
| InChIKey | PHJIIRNRWFPPAU-ZVEFXIOQSA-N |
| XLogP | 9.91 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.08 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|