C15H30N2O3S — CID 58709671
(2S)-N-[3-(2-tert-butylsulfanylethylamino)-3-oxopropyl]-2-hydroxy-3,3-dimethylbutanamide (PubChem CID 58709671) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is (2S)-N-[3-(2-tert-butylsulfanylethylamino)-3-oxopropyl]-2-hydroxy-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-[3-(2-tert-butylsulfanylethylamino)-3-oxopropyl]-2-hydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 58709671 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2S)-N-[3-(2-tert-butylsulfanylethylamino)-3-oxopropyl]-2-hydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)SCCNC(=O)CCNC(=O)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C15H30N2O3S/c1-14(2,3)12(19)13(20)17-8-7-11(18)16-9-10-21-15(4,5)6/h12,19H,7-10H2,1-6H3,(H,16,18)(H,17,20)/t12-/m1/s1 |
| InChIKey | DKPMUVXTGCEQOU-GFCCVEGCSA-N |
| XLogP | 1.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|