C35H57N3O4S2 — CID 90316958
(3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[2-[3-[[(2R)-2-hydroxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]henicosa-3,6,9,12,15,18-hexaenamide (PubChem CID 90316958) has the molecular formula C35H57N3O4S2 and a molecular weight of 647.99 g/mol. Its IUPAC name is (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[2-[3-[[(2R)-2-hydroxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]henicosa-3,6,9,12,15,18-hexaenamide.
| Compound Name | (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[2-[3-[[(2R)-2-hydroxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]henicosa-3,6,9,12,15,18-hexaenamide |
|---|---|
| PubChem CID | 90316958 |
| Molecular Formula | C35H57N3O4S2 |
| Molecular Weight | 647.99 g/mol |
| Exact Mass | 647.38 |
| IUPAC Name | (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[2-[3-[[(2R)-2-hydroxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]henicosa-3,6,9,12,15,18-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)NCCSSCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CC |
| InChI | InChI=1S/C35H57N3O4S2/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-31(39)36-27-29-43-44-30-28-37-32(40)25-26-38-34(42)33(41)35(3,4)6-2/h7-8,10-11,13-14,16-17,19-20,22-23,33,41H,5-6,9,12,15,18,21,24-30H2,1-4H3,(H,36,39)(H,37,40)(H,38,42)/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22-/t33-/m0/s1 |
| InChIKey | BIGTXVGMIMJTRG-LNOSLZOPSA-N |
| XLogP | 6.99 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.99 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|