C37H65N3O4S2 — CID 144673516
ethane;(5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[3-[[(2R)-2-methoxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 144673516) has the molecular formula C37H65N3O4S2 and a molecular weight of 680.08 g/mol. Its IUPAC name is ethane;(5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[3-[[(2R)-2-methoxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | ethane;(5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[3-[[(2R)-2-methoxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 144673516 |
| Molecular Formula | C37H65N3O4S2 |
| Molecular Weight | 680.08 g/mol |
| Exact Mass | 679.44 |
| IUPAC Name | ethane;(5Z,8Z,11Z,14Z,17Z)-N-[2-[2-[3-[[(2R)-2-methoxy-3,3-dimethylpentanoyl]amino]propanoylamino]ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC.CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@H](OC)C(C)(C)CC |
| InChI | InChI=1S/C35H59N3O4S2.C2H6/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-31(39)36-27-29-43-44-30-28-37-32(40)25-26-38-34(41)33(42-5)35(3,4)7-2;1-2/h8-9,11-12,14-15,17-18,20-21,33H,6-7,10,13,16,19,22-30H2,1-5H3,(H,36,39)(H,37,40)(H,38,41);1-2H3/b9-8-,12-11-,15-14-,18-17-,21-20-;/t33-;/m0./s1 |
| InChIKey | WKMDERAEDBTGCE-JVXJEALZSA-N |
| XLogP | 8.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.08 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|