C40H67NO5S2 — CID 157450313
(5Z,8Z,11Z,14Z,17Z)-N-[2-[[(9R)-9-methoxy-10,10-dimethyl-11-[(2-methylpropan-2-yl)oxy]-4,8-dioxoundecyl]disulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 157450313) has the molecular formula C40H67NO5S2 and a molecular weight of 706.11 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[2-[[(9R)-9-methoxy-10,10-dimethyl-11-[(2-methylpropan-2-yl)oxy]-4,8-dioxoundecyl]disulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[[(9R)-9-methoxy-10,10-dimethyl-11-[(2-methylpropan-2-yl)oxy]-4,8-dioxoundecyl]disulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 157450313 |
| Molecular Formula | C40H67NO5S2 |
| Molecular Weight | 706.11 g/mol |
| Exact Mass | 705.45 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[[(9R)-9-methoxy-10,10-dimethyl-11-[(2-methylpropan-2-yl)oxy]-4,8-dioxoundecyl]disulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCSSCCCC(=O)CCCC(=O)[C@H](OC)C(C)(C)COC(C)(C)C |
| InChI | InChI=1S/C40H67NO5S2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-30-37(44)41-31-33-48-47-32-26-28-35(42)27-25-29-36(43)38(45-7)40(5,6)34-46-39(2,3)4/h9-10,12-13,15-16,18-19,21-22,38H,8,11,14,17,20,23-34H2,1-7H3,(H,41,44)/b10-9-,13-12-,16-15-,19-18-,22-21-/t38-/m0/s1 |
| InChIKey | ZTZTYOALRZNOKY-UAVOQTTASA-N |
| XLogP | 10.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.11 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|