C34H58N2O4S2 — CID 144644132
(5Z,8Z,11Z,14Z,17Z)-N-[2-[4-[[(2R)-2,4-dimethoxy-3,3-dimethylbutanoyl]amino]butyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 144644132) has the molecular formula C34H58N2O4S2 and a molecular weight of 622.98 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[2-[4-[[(2R)-2,4-dimethoxy-3,3-dimethylbutanoyl]amino]butyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[4-[[(2R)-2,4-dimethoxy-3,3-dimethylbutanoyl]amino]butyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 144644132 |
| Molecular Formula | C34H58N2O4S2 |
| Molecular Weight | 622.98 g/mol |
| Exact Mass | 622.38 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[2-[4-[[(2R)-2,4-dimethoxy-3,3-dimethylbutanoyl]amino]butyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCSSCCCCNC(=O)[C@H](OC)C(C)(C)COC |
| InChI | InChI=1S/C34H58N2O4S2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-31(37)35-27-29-42-41-28-24-23-26-36-33(38)32(40-5)34(2,3)30-39-4/h7-8,10-11,13-14,16-17,19-20,32H,6,9,12,15,18,21-30H2,1-5H3,(H,35,37)(H,36,38)/b8-7-,11-10-,14-13-,17-16-,20-19-/t32-/m0/s1 |
| InChIKey | IRFNYABDBZYFEQ-HLCYNGIASA-N |
| XLogP | 7.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.98 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|