C30H50N2O7S2 — CID 78092022
N-[2-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 78092022) has the molecular formula C30H50N2O7S2 and a molecular weight of 614.87 g/mol. Its IUPAC name is N-[2-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | N-[2-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 78092022 |
| Molecular Formula | C30H50N2O7S2 |
| Molecular Weight | 614.87 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | N-[2-[2-(2,3,4,5,6-pentahydroxyhexanoylamino)ethyldisulfanyl]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCSSCCNC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C30H50N2O7S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(35)31-20-22-40-41-23-21-32-30(39)29(38)28(37)27(36)25(34)24-33/h3-4,6-7,9-10,12-13,15-16,25,27-29,33-34,36-38H,2,5,8,11,14,17-24H2,1H3,(H,31,35)(H,32,39) |
| InChIKey | FJVUOXLBWQIQEW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.87 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|