C11H23NO2S — CID 95174714
(2S)-N-(2-tert-butylsulfanylethyl)-2-ethoxypropanamide (PubChem CID 95174714) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is (2S)-N-(2-tert-butylsulfanylethyl)-2-ethoxypropanamide.
| Compound Name | (2S)-N-(2-tert-butylsulfanylethyl)-2-ethoxypropanamide |
|---|---|
| PubChem CID | 95174714 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2S)-N-(2-tert-butylsulfanylethyl)-2-ethoxypropanamide |
| SMILES | CCO[C@@H](C)C(=O)NCCSC(C)(C)C |
| InChI | InChI=1S/C11H23NO2S/c1-6-14-9(2)10(13)12-7-8-15-11(3,4)5/h9H,6-8H2,1-5H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | HNJPOQYCQHIWPT-VIFPVBQESA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|