C16H25NO3S — CID 28635088
(2R)-N-(2-tert-butylsulfanylethyl)-2-(3-methoxyphenoxy)propanamide (PubChem CID 28635088) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is (2R)-N-(2-tert-butylsulfanylethyl)-2-(3-methoxyphenoxy)propanamide.
| Compound Name | (2R)-N-(2-tert-butylsulfanylethyl)-2-(3-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 28635088 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2R)-N-(2-tert-butylsulfanylethyl)-2-(3-methoxyphenoxy)propanamide |
| SMILES | COc1cccc(O[C@H](C)C(=O)NCCSC(C)(C)C)c1 |
| InChI | InChI=1S/C16H25NO3S/c1-12(15(18)17-9-10-21-16(2,3)4)20-14-8-6-7-13(11-14)19-5/h6-8,11-12H,9-10H2,1-5H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | GSVJAVFSHGLDDR-GFCCVEGCSA-N |
| XLogP | 3.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|