C15H22ClNO2S — CID 94012025
(2S)-N-(2-tert-butylsulfanylethyl)-2-(3-chlorophenoxy)propanamide (PubChem CID 94012025) has the molecular formula C15H22ClNO2S and a molecular weight of 315.87 g/mol. Its IUPAC name is (2S)-N-(2-tert-butylsulfanylethyl)-2-(3-chlorophenoxy)propanamide.
| Compound Name | (2S)-N-(2-tert-butylsulfanylethyl)-2-(3-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 94012025 |
| Molecular Formula | C15H22ClNO2S |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (2S)-N-(2-tert-butylsulfanylethyl)-2-(3-chlorophenoxy)propanamide |
| SMILES | C[C@H](Oc1cccc(Cl)c1)C(=O)NCCSC(C)(C)C |
| InChI | InChI=1S/C15H22ClNO2S/c1-11(19-13-7-5-6-12(16)10-13)14(18)17-8-9-20-15(2,3)4/h5-7,10-11H,8-9H2,1-4H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | NLQWHZQTLBEBOB-NSHDSACASA-N |
| XLogP | 3.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|