C17H27NO2S — CID 43876130
N-(2-tert-butylsulfanylethyl)-2-(2,3-dimethylphenoxy)propanamide (PubChem CID 43876130) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-(2,3-dimethylphenoxy)propanamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-(2,3-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 43876130 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-(2,3-dimethylphenoxy)propanamide |
| SMILES | Cc1cccc(OC(C)C(=O)NCCSC(C)(C)C)c1C |
| InChI | InChI=1S/C17H27NO2S/c1-12-8-7-9-15(13(12)2)20-14(3)16(19)18-10-11-21-17(4,5)6/h7-9,14H,10-11H2,1-6H3,(H,18,19) |
| InChIKey | BWIZNSKYEBCEPJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|