C22H23NO2 — CID 133218986
2-(2,3-dimethylphenoxy)-N-(naphthalen-1-ylmethyl)propanamide (PubChem CID 133218986) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-(naphthalen-1-ylmethyl)propanamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-(naphthalen-1-ylmethyl)propanamide |
|---|---|
| PubChem CID | 133218986 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-(naphthalen-1-ylmethyl)propanamide |
| SMILES | Cc1cccc(OC(C)C(=O)NCc2cccc3ccccc23)c1C |
| InChI | InChI=1S/C22H23NO2/c1-15-8-6-13-21(16(15)2)25-17(3)22(24)23-14-19-11-7-10-18-9-4-5-12-20(18)19/h4-13,17H,14H2,1-3H3,(H,23,24) |
| InChIKey | AHUITYFUSRZGMB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |