C23H25NO5 — CID 132660138
2-naphthalen-1-yloxy-N-[(2,3,4-trimethoxyphenyl)methyl]propanamide (PubChem CID 132660138) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-naphthalen-1-yloxy-N-[(2,3,4-trimethoxyphenyl)methyl]propanamide.
| Compound Name | 2-naphthalen-1-yloxy-N-[(2,3,4-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 132660138 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-naphthalen-1-yloxy-N-[(2,3,4-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)C(C)Oc2cccc3ccccc23)c(OC)c1OC |
| InChI | InChI=1S/C23H25NO5/c1-15(29-19-11-7-9-16-8-5-6-10-18(16)19)23(25)24-14-17-12-13-20(26-2)22(28-4)21(17)27-3/h5-13,15H,14H2,1-4H3,(H,24,25) |
| InChIKey | KFKUDAWTZPAVQH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |