C19H22FNO2 — CID 39710056
(2R)-2-(2,3-dimethylphenoxy)-N-[2-(4-fluorophenyl)ethyl]propanamide (PubChem CID 39710056) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is (2R)-2-(2,3-dimethylphenoxy)-N-[2-(4-fluorophenyl)ethyl]propanamide.
| Compound Name | (2R)-2-(2,3-dimethylphenoxy)-N-[2-(4-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 39710056 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (2R)-2-(2,3-dimethylphenoxy)-N-[2-(4-fluorophenyl)ethyl]propanamide |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NCCc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C19H22FNO2/c1-13-5-4-6-18(14(13)2)23-15(3)19(22)21-12-11-16-7-9-17(20)10-8-16/h4-10,15H,11-12H2,1-3H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | GOYQRSJXOXLIRX-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |