C30H46INO5 — CID 90215404
[(3R)-3-iodooxy-2,2-dimethyl-4-oxo-4-(3-oxobutylamino)butyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 90215404) has the molecular formula C30H46INO5 and a molecular weight of 627.60 g/mol. Its IUPAC name is [(3R)-3-iodooxy-2,2-dimethyl-4-oxo-4-(3-oxobutylamino)butyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [(3R)-3-iodooxy-2,2-dimethyl-4-oxo-4-(3-oxobutylamino)butyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 90215404 |
| Molecular Formula | C30H46INO5 |
| Molecular Weight | 627.60 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | [(3R)-3-iodooxy-2,2-dimethyl-4-oxo-4-(3-oxobutylamino)butyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(C)(C)[C@@H](OI)C(=O)NCCC(C)=O |
| InChI | InChI=1S/C30H46INO5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(34)36-25-30(3,4)28(37-31)29(35)32-24-23-26(2)33/h6-7,9-10,12-13,15-16,18-19,28H,5,8,11,14,17,20-25H2,1-4H3,(H,32,35)/b7-6-,10-9-,13-12-,16-15-,19-18-/t28-/m0/s1 |
| InChIKey | VLWPAYXYOITBEN-GOCZMYEYSA-N |
| XLogP | 7.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.60 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|