C34H54INO4 — CID 138713311
[(3R)-4-[(4,4-dimethyl-3-oxopentyl)amino]-3-(iodomethyl)-2,2-dimethyl-4-oxobutyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 138713311) has the molecular formula C34H54INO4 and a molecular weight of 667.71 g/mol. Its IUPAC name is [(3R)-4-[(4,4-dimethyl-3-oxopentyl)amino]-3-(iodomethyl)-2,2-dimethyl-4-oxobutyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [(3R)-4-[(4,4-dimethyl-3-oxopentyl)amino]-3-(iodomethyl)-2,2-dimethyl-4-oxobutyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 138713311 |
| Molecular Formula | C34H54INO4 |
| Molecular Weight | 667.71 g/mol |
| Exact Mass | 667.31 |
| IUPAC Name | [(3R)-4-[(4,4-dimethyl-3-oxopentyl)amino]-3-(iodomethyl)-2,2-dimethyl-4-oxobutyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(C)(C)[C@@H](CI)C(=O)NCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C34H54INO4/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-31(38)40-28-34(5,6)29(27-35)32(39)36-26-25-30(37)33(2,3)4/h8-9,11-12,14-15,17-18,20-21,29H,7,10,13,16,19,22-28H2,1-6H3,(H,36,39)/b9-8-,12-11-,15-14-,18-17-,21-20-/t29-/m0/s1 |
| InChIKey | PGWQGPBWAZCISL-VAANDTQOSA-N |
| XLogP | 8.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.71 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|