C24H37NO3S — CID 71570239
[2-oxo-2-(2-sulfanylethylamino)ethyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 71570239) has the molecular formula C24H37NO3S and a molecular weight of 419.63 g/mol. Its IUPAC name is [2-oxo-2-(2-sulfanylethylamino)ethyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [2-oxo-2-(2-sulfanylethylamino)ethyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 71570239 |
| Molecular Formula | C24H37NO3S |
| Molecular Weight | 419.63 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | [2-oxo-2-(2-sulfanylethylamino)ethyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC(=O)NCCS |
| InChI | InChI=1S/C24H37NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(27)28-22-23(26)25-20-21-29/h3-4,6-7,9-10,12-13,15-16,29H,2,5,8,11,14,17-22H2,1H3,(H,25,26)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | IDICWZMDHREHJM-JLNKQSITSA-N |
| XLogP | 5.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|