C12H23N3O3S3 — CID 10132786
1-N,2-N,3-N-tris(2-sulfanylethyl)propane-1,2,3-tricarboxamide (PubChem CID 10132786) has the molecular formula C12H23N3O3S3 and a molecular weight of 353.54 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris(2-sulfanylethyl)propane-1,2,3-tricarboxamide.
| Compound Name | 1-N,2-N,3-N-tris(2-sulfanylethyl)propane-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 10132786 |
| Molecular Formula | C12H23N3O3S3 |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-N,2-N,3-N-tris(2-sulfanylethyl)propane-1,2,3-tricarboxamide |
| SMILES | O=C(CC(CC(=O)NCCS)C(=O)NCCS)NCCS |
| InChI | InChI=1S/C12H23N3O3S3/c16-10(13-1-4-19)7-9(12(18)15-3-6-21)8-11(17)14-2-5-20/h9,19-21H,1-8H2,(H,13,16)(H,14,17)(H,15,18) |
| InChIKey | PSSLQTSZFPQDJK-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|