C21H38N6O9 — CID 13417378
1-N,2-N,3-N-tris[3-[acetyl(hydroxy)amino]propyl]propane-1,2,3-tricarboxamide (PubChem CID 13417378) has the molecular formula C21H38N6O9 and a molecular weight of 518.57 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris[3-[acetyl(hydroxy)amino]propyl]propane-1,2,3-tricarboxamide.
| Compound Name | 1-N,2-N,3-N-tris[3-[acetyl(hydroxy)amino]propyl]propane-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 13417378 |
| Molecular Formula | C21H38N6O9 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 1-N,2-N,3-N-tris[3-[acetyl(hydroxy)amino]propyl]propane-1,2,3-tricarboxamide |
| SMILES | CC(=O)N(O)CCCNC(=O)CC(CC(=O)NCCCN(O)C(C)=O)C(=O)NCCCN(O)C(C)=O |
| InChI | InChI=1S/C21H38N6O9/c1-15(28)25(34)10-4-7-22-19(31)13-18(21(33)24-9-6-12-27(36)17(3)30)14-20(32)23-8-5-11-26(35)16(2)29/h18,34-36H,4-14H2,1-3H3,(H,22,31)(H,23,32)(H,24,33) |
| InChIKey | KVLKCURTYHVKNO-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 208.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|