C5H13N2O2+ — CID 25201397
3-[acetyl(hydroxy)amino]propylazanium (PubChem CID 25201397) has the molecular formula C5H13N2O2+ and a molecular weight of 133.17 g/mol. Its IUPAC name is 3-[acetyl(hydroxy)amino]propylazanium.
| Compound Name | 3-[acetyl(hydroxy)amino]propylazanium |
|---|---|
| PubChem CID | 25201397 |
| Molecular Formula | C5H13N2O2+ |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.10 |
| IUPAC Name | 3-[acetyl(hydroxy)amino]propylazanium |
| SMILES | CC(=O)N(O)CCC[NH3+] |
| InChI | InChI=1S/C5H12N2O2/c1-5(8)7(9)4-2-3-6/h9H,2-4,6H2,1H3/p+1 |
| InChIKey | GESGFMPICZBILN-UHFFFAOYSA-O |
| XLogP | -1.14 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|