About N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide
N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide (PubChem CID 19607288) has the molecular formula C7H14N2O3S
and a molecular weight of 206.27 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide |
| PubChem CID | 19607288 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide |
| SMILES | O=C(CC(=O)NCCS)NCCO |
| InChI | InChI=1S/C7H14N2O3S/c10-3-1-8-6(11)5-7(12)9-2-4-13/h10,13H,1-5H2,(H,8,11)(H,9,12) |
| InChIKey | IVDMPRJPWMJHIP-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide?
The IUPAC name of N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide (CID 19607288) is N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide.
What is the SMILES notation for N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide?
The canonical SMILES for N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide is O=C(CC(=O)NCCS)NCCO.
What is the InChIKey of N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide?
The InChIKey is IVDMPRJPWMJHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O3S/c10-3-1-8-6(11)5-7(12)9-2-4-13/h10,13H,1-5H2,(H,8,11)(H,9,12).
What are the key properties of N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide?
N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide has a molecular weight of 206.27 g/mol, XLogP of -1.47, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-N'-(2-sulfanylethyl)propanediamide is sourced from PubChem (CID 19607288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).