C8H16N2O4S2 — CID 87982116
N,N'-bis(2-hydroxyethyl)-2,2-bis(sulfanyl)butanediamide (PubChem CID 87982116) has the molecular formula C8H16N2O4S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is N,N'-bis(2-hydroxyethyl)-2,2-bis(sulfanyl)butanediamide.
| Compound Name | N,N'-bis(2-hydroxyethyl)-2,2-bis(sulfanyl)butanediamide |
|---|---|
| PubChem CID | 87982116 |
| Molecular Formula | C8H16N2O4S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N,N'-bis(2-hydroxyethyl)-2,2-bis(sulfanyl)butanediamide |
| SMILES | O=C(CC(S)(S)C(=O)NCCO)NCCO |
| InChI | InChI=1S/C8H16N2O4S2/c11-3-1-9-6(13)5-8(15,16)7(14)10-2-4-12/h11-12,15-16H,1-5H2,(H,9,13)(H,10,14) |
| InChIKey | ZLZLXZUXIOKHTC-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|