C10H20N4O4 — CID 91073523
2-acetyl-2-amino-N-(2-aminoethyl)-N'-(2-hydroxyethyl)butanediamide (PubChem CID 91073523) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-acetyl-2-amino-N-(2-aminoethyl)-N'-(2-hydroxyethyl)butanediamide.
| Compound Name | 2-acetyl-2-amino-N-(2-aminoethyl)-N'-(2-hydroxyethyl)butanediamide |
|---|---|
| PubChem CID | 91073523 |
| Molecular Formula | C10H20N4O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-acetyl-2-amino-N-(2-aminoethyl)-N'-(2-hydroxyethyl)butanediamide |
| SMILES | CC(=O)C(N)(CC(=O)NCCO)C(=O)NCCN |
| InChI | InChI=1S/C10H20N4O4/c1-7(16)10(12,9(18)14-3-2-11)6-8(17)13-4-5-15/h15H,2-6,11-12H2,1H3,(H,13,17)(H,14,18) |
| InChIKey | ZXXRYQNNBNDRKH-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|